Difference between revisions of "RXN-14225"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14766 CPD-14766] == * smiles: ** CCCCCCCCCCCCCCC(O)[CH]=O * inchi key: ** InChIKey=BKBDVQVD...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14766 CPD-14766] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCC(O)[CH]=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BKBDVQVDRVGXKT-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 2-hydroxyhexadecanal |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 256.428 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13729]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18987871 18987871] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50626 50626] |
− | + | {{#set: smiles=CCCCCCCCCCCCCCC(O)[CH]=O}} | |
− | + | {{#set: inchi key=InChIKey=BKBDVQVDRVGXKT-UHFFFAOYSA-N}} | |
− | + | {{#set: common name=2-hydroxyhexadecanal}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=256.428 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-13729}} |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:27, 10 January 2018
Contents
Metabolite CPD-14766
- smiles:
- CCCCCCCCCCCCCCC(O)[CH]=O
- inchi key:
- InChIKey=BKBDVQVDRVGXKT-UHFFFAOYSA-N
- common name:
- 2-hydroxyhexadecanal
- molecular weight:
- 256.428
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCC(O)[CH]=O" cannot be used as a page name in this wiki.