Difference between revisions of "RXN-12583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LYSDECARBOX-RXN LYSDECARBOX-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.ex...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LYSDECARBOX-RXN LYSDECARBOX-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.1.1.18 EC-4.1.1.18]
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
 +
* common name:
 +
** dCTP
 +
* molecular weight:
 +
** 463.127   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2'-deoxycytidine-5'-triphosphate
 +
** deoxycytidine-triphosphate
 +
** deoxy-CTP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14198]]
−
** 1 [[PROTON]][c] '''+''' 1 [[LYS]][c] '''=>''' 1 [[CADAVERINE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[DCTP-PYROPHOSPHATASE-RXN]]
−
* With common name(s):
+
* [[DCTCP]]
−
** 1 H+[c] '''+''' 1 L-lysine[c] '''=>''' 1 cadaverine[c] '''+''' 1 CO2[c]
+
* [[RME255]]
−
 
+
* [[DCTUP]]
−
== Genes associated with this reaction  ==
+
* [[RXN-14216]]
−
Genes have been associated with this reaction based on different elements listed below.
+
== Reaction(s) known to produce the compound ==
−
* [[Tiso_gene_10395]]
+
* [[ATDCD]]
−
** [[pantograph]]-[[synechocystis]]
+
* [[DCDPKIN-RXN]]
−
== Pathways  ==
+
* [[ATDCDm]]
−
* [[PWY0-461]], L-lysine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-461 PWY0-461]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-5468]], lupanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5468 PWY-5468]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6381]], bisucaberin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6381 PWY-6381]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY0-1303]], aminopropylcadaverine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1303 PWY0-1303]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6328]], L-lysine degradation X: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6328 PWY-6328]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6375]], desferrioxamine E biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6375 PWY-6375]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6376]], desferrioxamine B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6376 PWY-6376]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 2056-98-6
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22352 22352]
+
* PUBCHEM:
−
* LIGAND-RXN:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00462 R00462]
+
* HMDB : HMDB00998
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P05033 P05033]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
−
** [http://www.uniprot.org/uniprot/P21885 P21885]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/P0A9H3 P0A9H3]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
−
** [http://www.uniprot.org/uniprot/P52095 P52095]
+
* BIGG : dctp
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
−
{{#set: ec number=EC-4.1.1.18}}
+
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
−
{{#set: gene associated=Tiso_gene_10395}}
+
{{#set: common name=dCTP}}
−
{{#set: in pathway=PWY0-461|PWY-5468|PWY-6381|PWY0-1303|PWY-6328|PWY-6375|PWY-6376}}
+
{{#set: molecular weight=463.127    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}}
−
{{#set: reconstruction source=synechocystis}}
+
{{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}}

Revision as of 17:27, 10 January 2018

Metabolite DCTP

  • smiles:
    • C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
  • common name:
    • dCTP
  • molecular weight:
    • 463.127
  • Synonym(s):
    • 2'-deoxycytidine-5'-triphosphate
    • deoxycytidine-triphosphate
    • deoxy-CTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2056-98-6
  • PUBCHEM:
  • HMDB : HMDB00998
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : dctp
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12583&oldid=17861"