Difference between revisions of "RXN-9597"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * inchi key: ** InChIKey=OSJPPGNTCRNQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN] == * direction: ** LEFT-TO-R...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 4-hydroxybenzoate_octaprenyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | + | * With identifiers: | |
− | * [[ | + | ** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[OCTAPRENYL-DIPHOSPHATE]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[3-OCTAPRENYL-4-HYDROXYBENZOATE]][c] |
− | + | * With common name(s): | |
− | + | ** 1 4-hydroxybenzoate[c] '''+''' 1 all-trans-octaprenyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 3-octaprenyl-4-hydroxybenzoate[c] | |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * [[Tiso_gene_4719]] |
− | * [[ | + | ** IN-SILICO_ANNOTATION |
− | * [[ | + | ***AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
+ | * [[PWY-6708]], ubiquinol-8 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6708 PWY-6708] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-5870]], ubiquinol-8 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5870 PWY-5870] | ||
+ | ** '''3''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27782 27782] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05615 R05615] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=4-hydroxybenzoate_octaprenyltransferase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.5.1.39}} |
− | + | {{#set: gene associated=Tiso_gene_4719}} | |
− | + | {{#set: in pathway=PWY-6708|PWY-5870}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=in-silico_annotation}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:27, 10 January 2018
Contents
Reaction 4OHBENZOATE-OCTAPRENYLTRANSFER-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-hydroxybenzoate_octaprenyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-hydroxybenzoate[c] + 1 OCTAPRENYL-DIPHOSPHATE[c] => 1 PPI[c] + 1 3-OCTAPRENYL-4-HYDROXYBENZOATE[c]
- With common name(s):
- 1 4-hydroxybenzoate[c] + 1 all-trans-octaprenyl diphosphate[c] => 1 diphosphate[c] + 1 3-octaprenyl-4-hydroxybenzoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_4719
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
Pathways
- PWY-6708, ubiquinol-8 biosynthesis (prokaryotic): PWY-6708
- 4 reactions found over 8 reactions in the full pathway
- PWY-5870, ubiquinol-8 biosynthesis (eukaryotic): PWY-5870
- 3 reactions found over 9 reactions in the full pathway
Reconstruction information
External links