Difference between revisions of "DTDPGLUCOSEPP-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5425 == * left end position: ** 7226 * transcription direction: ** POSITIVE * right end position: ** 9247 * centisome position: ** 53.57752...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5425 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] ==
* left end position:
+
* smiles:
** 7226
+
** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
* transcription direction:
+
* common name:
** POSITIVE
+
** myosin light-chain phosphate
* right end position:
+
** 9247
+
* centisome position:
+
** 53.57752   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.2.1.31-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[2.7.11.18-RXN]]
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[ALCOHOL-DEHYDROG-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[ALLYSINE-DEHYDROG-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10781]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10855]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10911]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10915]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12448]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12560]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-13198]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-13279]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-5424]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-5901]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7644]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7657]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7693]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7694]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7700]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-7706]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN3O-4113]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN66-478]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY66-21]]
+
* [[PWY-7111]]
+
* [[PWY-6587]]
+
* [[PWY-5676]]
+
* [[PWY-5082]]
+
* [[PWY-7118]]
+
* [[PWY-7013]]
+
* [[PWY-3162]]
+
* [[PWY-5751]]
+
* [[PWY-6342]]
+
* [[PWY1-3]]
+
* [[P161-PWY]]
+
* [[ETOH-ACETYLCOA-ANA-PWY]]
+
* [[FERMENTATION-PWY]]
+
* [[PWY-6871]]
+
* [[PWY-7396]]
+
* [[PWY-5057]]
+
* [[PWY-5741]]
+
* [[PWY-5076]]
+
* [[PWY-6333]]
+
* [[PWY-5486]]
+
* [[PWY-5079]]
+
* [[PWY-5078]]
+
* [[PWY-6313]]
+
* [[PWY66-425]]
+
* [[PWY-5480]]
+
* [[PWY3O-4108]]
+
* [[PWY-7216]]
+
* [[PWY-6802]]
+
* [[LYSINE-DEG1-PWY]]
+
* [[P122-PWY]]
+
* [[PWY66-389]]
+
* [[PWY4LZ-257]]
+
* [[PWY-4101]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=7226}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03875 C03875]
{{#set: right end position=9247}}
+
{{#set: smiles=C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]}}
{{#set: centisome position=53.57752    }}
+
{{#set: common name=myosin light-chain phosphate}}
{{#set: reaction associated=1.2.1.31-RXN|ALCOHOL-DEHYDROG-GENERIC-RXN|ALCOHOL-DEHYDROG-RXN|ALLYSINE-DEHYDROG-RXN|L-IDITOL-2-DEHYDROGENASE-RXN|PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN|RXN-10781|RXN-10855|RXN-10911|RXN-10915|RXN-12448|RXN-12560|RXN-13198|RXN-13279|RXN-5424|RXN-5901|RXN-7644|RXN-7657|RXN-7693|RXN-7694|RXN-7700|RXN-7706|RXN3O-4113|RXN66-478}}
+
{{#set: consumed or produced by=2.7.11.18-RXN}}
{{#set: pathway associated=PWY66-21|PWY-7111|PWY-6587|PWY-5676|PWY-5082|PWY-7118|PWY-7013|PWY-3162|PWY-5751|PWY-6342|PWY1-3|P161-PWY|ETOH-ACETYLCOA-ANA-PWY|FERMENTATION-PWY|PWY-6871|PWY-7396|PWY-5057|PWY-5741|PWY-5076|PWY-6333|PWY-5486|PWY-5079|PWY-5078|PWY-6313|PWY66-425|PWY-5480|PWY3O-4108|PWY-7216|PWY-6802|LYSINE-DEG1-PWY|P122-PWY|PWY66-389|PWY4LZ-257|PWY-4101}}
+

Revision as of 17:28, 10 January 2018

Metabolite CPD-8563

  • smiles:
    • C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
  • common name:
    • myosin light-chain phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.