Difference between revisions of "3-OXOADIPATE-ENOL-LACTONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME294 RME294] == * direction: ** LEFT-TO-RIGHT * common name: ** RME294 * Synonym(s): == Reaction...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME294 RME294] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
 
* common name:
 
* common name:
−
** RME294
+
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
 +
* molecular weight:
 +
** 728.942   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16121]]
−
** 32.687 [[WATER]][c] '''+''' 0.0402 [[RNA-Holder]][c] '''+''' 0.0026 [[CHLOROPHYLL-A]][c] '''+''' 0.8456 [[General-Protein-Substrates]][c] '''+''' 0.0014 [[DNA-Holder]][c] '''+''' 32.687 [[ATP]][c] '''+''' 0.1118 [[L-PHOSPHATIDATE]][c] '''=>''' 32.687 [[PROTON]][c] '''+''' 1.0 [[Biomass-Compositions]][c] '''+''' 32.687 [[ADP]][c] '''+''' 32.687 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-16118]]
−
**
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=RME294}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824]
−
{{#set: in pathway=}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}}
−
{{#set: reconstruction category=manual}}
+
{{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}}
−
{{#set: reconstruction source=primary_network}}
+
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
 +
{{#set: molecular weight=728.942    }}
 +
{{#set: consumed by=RXN-16121}}
 +
{{#set: produced by=RXN-16118}}

Revision as of 17:28, 10 January 2018

Metabolite CPD-17373

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
  • inchi key:
    • InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
  • common name:
    • 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
  • molecular weight:
    • 728.942
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-OXOADIPATE-ENOL-LACTONE&oldid=17966"