Difference between revisions of "TRNA-Arg-inosine34"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M |
* common name: | * common name: | ||
− | ** | + | ** 4-amino-4-deoxychorismate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 224.193 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ADCLY-RXN]] |
+ | * [[PABASYN-RXN]] | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 97279-79-3 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406] |
− | * | + | * BIGG : 4adcho |
− | {{#set: smiles=C( | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355] |
− | {{#set: common name= | + | {{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}} |
− | + | {{#set: common name=4-amino-4-deoxychorismate}} | |
− | + | {{#set: molecular weight=224.193 }} | |
− | {{#set: consumed or produced by= | + | {{#set: consumed or produced by=ADCLY-RXN|PABASYN-RXN}} |
Revision as of 15:46, 10 January 2018
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- smiles:
- C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
- inchi key:
- InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
- common name:
- 4-amino-4-deoxychorismate
- molecular weight:
- 224.193
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)" cannot be used as a page name in this wiki.