Difference between revisions of "RXN-9530"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] == * smiles: ** CC(C[N+])C([O-])=O * inchi key: ** InChIKey=QCHPKSFMDHPSNR-VKH...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Keratan-sulfate-NAcGlc Keratan-sulfate-NAcGlc] == * common name: ** [keratan sulfate]-α-N...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Keratan-sulfate-NAcGlc Keratan-sulfate-NAcGlc] ==
* smiles:
+
** CC(C[N+])C([O-])=O
+
* inchi key:
+
** InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N
+
 
* common name:
 
* common name:
** (S)-3-amino-2-methylpropanoate
+
** [keratan sulfate]-α-N-acetyl-D-glucosamine
* molecular weight:
+
** 103.121   
+
 
* Synonym(s):
 
* Synonym(s):
** L-3-amino-isobutanoate
+
** a keratan glucosamine
** (S)-3-amino-isobutyric acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.6.1.22-RXN]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=[keratan sulfate]-α-N-acetyl-D-glucosamine}}
** [http://www.genome.jp/dbget-bin/www_bget?C03284 C03284]
+
{{#set: common name=a keratan glucosamine}}
* CHEBI:
+
{{#set: produced by=RXN-11570}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58655 58655]
+
* METABOLIGHTS : MTBLC58655
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971062 6971062]
+
* HMDB : HMDB02166
+
{{#set: smiles=CC(C[N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N}}
+
{{#set: common name=(S)-3-amino-2-methylpropanoate}}
+
{{#set: molecular weight=103.121    }}
+
{{#set: common name=L-3-amino-isobutanoate|(S)-3-amino-isobutyric acid}}
+
{{#set: consumed or produced by=2.6.1.22-RXN}}
+

Revision as of 18:29, 10 January 2018

Metabolite Keratan-sulfate-NAcGlc

  • common name:
    • [keratan sulfate]-α-N-acetyl-D-glucosamine
  • Synonym(s):
    • a keratan glucosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"keratan sulfate]-α-N-acetyl-D-glucosamine" cannot be used as a page name in this wiki.