Difference between revisions of "RXN-2902"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] == * smiles: ** C([N+])C2(C1(C(=O)NC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4230 RXN-4230] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-AMINOMETHYL-7-DEAZAGUANINE 7-AMINOMETHYL-7-DEAZAGUANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4230 RXN-4230] ==
−
* smiles:
+
* direction:
−
** C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O
+
** [http://enzyme.expasy.org/EC/1.14.13 EC-1.14.13]
−
* common name:
+
−
** preQ1
+
−
* molecular weight:
+
−
** 180.189   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-aminomethyl-7-deazaguanine
 
−
** 7-aminomethyl-7-carbaguanine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-1321]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-709]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-3946]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (5α)-campestan-3-one[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''=>''' 1 (22S,24R)-22-hydroxy-5α-ergostan-3-one[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8263]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_3577]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-2582]], brassinosteroid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582]
 +
** '''7''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202264 25202264]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07453 R07453]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58703 58703]
+
{{#set: ec number=EC-1.14.13}}
−
{{#set: smiles=C([N+])C2(C1(C(=O)NC(N)=NC=1NC=2))}}
+
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_3577}}
−
{{#set: inchi key=InChIKey=MEYMBLGOKYDGLZ-UHFFFAOYSA-O}}
+
{{#set: in pathway=PWY-2582}}
−
{{#set: common name=preQ1}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=180.189    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=7-aminomethyl-7-deazaguanine|7-aminomethyl-7-carbaguanine}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: consumed by=RXN0-1321}}
+

Revision as of 17:30, 10 January 2018

Reaction RXN-4230

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (5α)-campestan-3-one[c] + 1 NADPH[c] + 1 oxygen[c] + 1 H+[c] => 1 (22S,24R)-22-hydroxy-5α-ergostan-3-one[c] + 1 NADP+[c] + 1 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2582, brassinosteroid biosynthesis II: PWY-2582
    • 7 reactions found over 21 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-2902&oldid=18082"