|
|
Line 1: |
Line 1: |
− | [[Category:Metabolite]] | + | [[Category:Reaction]] |
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYL-HOMO-CYS ADENOSYL-HOMO-CYS] == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R02292 R02292] == |
− | * smiles: | + | * direction: |
− | ** C(SCC3(C(O)C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))CC(C([O-])=O)[N+] | + | ** LEFT-TO-RIGHT |
− | * inchi key:
| + | |
− | ** InChIKey=ZJUKTBDSGOFHSH-WFMPWKQPSA-N
| + | |
| * common name: | | * common name: |
− | ** S-adenosyl-L-homocysteine | + | ** R72 |
− | * molecular weight:
| + | |
− | ** 384.409
| + | |
| * Synonym(s): | | * Synonym(s): |
− | ** S-adenosylhomocysteine
| |
− | ** 2-S-adenosyl-L-homocysteine
| |
− | ** AdoHcy
| |
− | ** S-adenosyl-homocysteine
| |
− | ** adenosyl-homo-cys
| |
− | ** adenosylhomocysteine
| |
− | ** adenosylhomo-cys
| |
− | ** SAH
| |
| | | |
− | == Reaction(s) known to consume the compound == | + | == Reaction Formula == |
− | * [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]] | + | * With identifiers: |
− | == Reaction(s) known to produce the compound ==
| + | ** 1.0 [[PYRUVATE]][c] '''+''' 1.0 [[L-ASPARTATE-SEMIALDEHYDE]][c] '''=>''' 1.0 [[2-3-DIHYDRODIPICOLINATE]][c] '''+''' 2.0 [[WATER]][c] |
− | * [[RXN0-5063]] | + | * With common name(s): |
− | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] | + | ** 1.0 pyruvate[c] '''+''' 1.0 L-aspartate-semialdehyde[c] '''=>''' 1.0 (S)-2,3-dihydrodipicolinate[c] '''+''' 2.0 H2O[c] |
− | * [[RXN-14177]]
| + | |
− | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
| + | == Genes associated with this reaction == |
− | * [[2.1.1.137-RXN]]
| + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[RXN-1104]]
| + | * [[Tiso_gene_14829]] |
− | * [[RXN-2762]]
| + | ** [[pantograph]]-[[synechocystis]] |
− | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
| + | == Pathways == |
− | * [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
| + | == Reconstruction information == |
− | * [[RXN-1143]]
| + | * [[orthology]]: |
− | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
| + | ** [[pantograph]]: |
− | * [[2.1.1.109-RXN]]
| + | *** [[synechocystis]] |
− | * [[UROPORIIIMETHYLTRANSA-RXN]]
| + | |
− | * [[RXN-10847]]
| + | |
− | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
| + | |
− | * [[RXN-12375]]
| + | |
− | * [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
| + | |
− | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-11046]] | + | |
− | * [[RXN1G-2544]] | + | |
− | * [[RXN-2542]] | + | |
− | * [[RXN-11374]]
| + | |
− | * [[RXN-11373]]
| + | |
− | * [[RXN-11370]]
| + | |
− | * [[RXN-13403]]
| + | |
− | * [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-9500]]
| + | |
− | * [[RXN-13406]]
| + | |
− | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN1G-3641]]
| + | |
− | * [[RXN-3422]]
| + | |
− | * [[RXN-12377]]
| + | |
− | * [[2.1.1.138-RXN]]
| + | |
− | * [[2.1.1.113-RXN]]
| + | |
− | * [[RXN-12376]]
| + | |
− | * [[2.1.1.143-RXN]]
| + | |
− | * [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-7605]]
| + | |
− | * [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-13935]]
| + | |
− | * [[RXN0-5144]]
| + | |
− | * [[RXN-14326]]
| + | |
− | * [[DHHB-METHYLTRANSFER-RXN]]
| + | |
− | * [[RXN-2562]]
| + | |
− | * [[RXN0-6515]]
| + | |
− | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
| + | |
− | * [[2.1.1.127-RXN]]
| + | |
− | * [[RXN0-5419]]
| + | |
− | * [[R06859]]
| + | |
− | * [[RXN-12459]]
| + | |
− | * [[RXN-9235]]
| + | |
− | * [[RXN-11856]]
| + | |
− | * [[RXN-12348]]
| + | |
− | * [[2.1.1.77-RXN]]
| + | |
− | * [[2.1.1.79-RXN]]
| + | |
− | * [[RXN-11637]]
| + | |
− | * [[RXN-14481]]
| + | |
− | * [[RXN-13588]]
| + | |
− | * [[RXN-11633]] | + | |
− | * [[RXN-4021]] | + | |
− | * [[RXN-11201]] | + | |
− | * [[RXN-11574]]
| + | |
− | * [[RXN-11598]]
| + | |
− | * [[RXN-8675]]
| + | |
− | * [[RXN-14917]]
| + | |
− | * [[RXN-11638]]
| + | |
− | == Reaction(s) of unknown directionality == | + | |
− | * [[ADENOSYLHOMOCYSTEINASE-RXN]] | + | |
− | * [[AMETt2h]] | + | |
− | * [[AMETt2m]] | + | |
| == External links == | | == External links == |
− | * CAS : 979-92-0
| + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * METABOLIGHTS : MTBLC57856
| + | {{#set: common name=R72}} |
− | * PUBCHEM:
| + | {{#set: gene associated=Tiso_gene_14829}} |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246222 25246222]
| + | {{#set: in pathway=}} |
− | * HMDB : HMDB00939
| + | {{#set: reconstruction category=orthology}} |
− | * LIGAND-CPD:
| + | {{#set: reconstruction tool=pantograph}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?C00021 C00021]
| + | {{#set: reconstruction source=synechocystis}} |
− | * CHEBI:
| + | |
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57856 57856]
| + | |
− | * BIGG : ahcys
| + | |
− | {{#set: smiles=C(SCC3(C(O)C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))CC(C([O-])=O)[N+]}} | + | |
− | {{#set: inchi key=InChIKey=ZJUKTBDSGOFHSH-WFMPWKQPSA-N}}
| + | |
− | {{#set: common name=S-adenosyl-L-homocysteine}} | + | |
− | {{#set: molecular weight=384.409 }} | + | |
− | {{#set: common name=S-adenosylhomocysteine|2-S-adenosyl-L-homocysteine|AdoHcy|S-adenosyl-homocysteine|adenosyl-homo-cys|adenosylhomocysteine|adenosylhomo-cys|SAH}} | + | |
− | {{#set: consumed by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}} | + | |
− | {{#set: produced by=RXN0-5063|RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN|RXN-14177|NICOTINAMIDE-N-METHYLTRANSFERASE-RXN|2.1.1.137-RXN|RXN-1104|RXN-2762|2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN|HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN|RXN-1143|QUERCETIN-3-O-METHYLTRANSFERASE-RXN|2.1.1.109-RXN|UROPORIIIMETHYLTRANSA-RXN|RXN-10847|2-OCTAPRENYL-6-OHPHENOL-METHY-RXN|RXN-12375|DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN|HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-11046|RXN1G-2544|RXN-2542|RXN-11374|RXN-11373|RXN-11370|RXN-13403|MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN|RXN-9500|RXN-13406|TOCOPHEROL-O-METHYLTRANSFERASE-RXN|RXN1G-3641|RXN-3422|RXN-12377|2.1.1.138-RXN|2.1.1.113-RXN|RXN-12376|2.1.1.143-RXN|TRNA-URACIL-5--METHYLTRANSFERASE-RXN|RXN-7605|TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN|RXN-13935|RXN0-5144|RXN-14326|DHHB-METHYLTRANSFER-RXN|RXN-2562|RXN0-6515|CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN|2.1.1.127-RXN|RXN0-5419|R06859|RXN-12459|RXN-9235|RXN-11856|RXN-12348|2.1.1.77-RXN|2.1.1.79-RXN|RXN-11637|RXN-14481|RXN-13588|RXN-11633|RXN-4021|RXN-11201|RXN-11574|RXN-11598|RXN-8675|RXN-14917|RXN-11638}} | + | |
− | {{#set: consumed or produced by=ADENOSYLHOMOCYSTEINASE-RXN|AMETt2h|AMETt2m}} | + | |
Genes have been associated with this reaction based on different elements listed below.