Difference between revisions of "Tiso gene 16224"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)O)O)=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J |
* common name: | * common name: | ||
| − | ** | + | ** D-ribulose-1,5-bisphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 306.059 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ribulose 1,5-bisphosphate |
| − | ** | + | ** D-ribulose-1,5-diphosphate |
| + | ** D-ribulose-1,5-P2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
== External links == | == External links == | ||
| + | * CAS : 14689-84-0 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182] |
| − | {{#set: smiles=C( | + | {{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=D-ribulose-1,5-bisphosphate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=306.059 }} |
| − | {{#set: common name= | + | {{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}} |
| − | {{#set: consumed or produced by= | + | {{#set: consumed by=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}} |
| + | {{#set: consumed or produced by=PHOSPHORIBULOKINASE-RXN}} | ||
Revision as of 17:30, 10 January 2018
Contents
Metabolite D-RIBULOSE-15-P2
- smiles:
- C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
- common name:
- D-ribulose-1,5-bisphosphate
- molecular weight:
- 306.059
- Synonym(s):
- ribulose 1,5-bisphosphate
- D-ribulose-1,5-diphosphate
- D-ribulose-1,5-P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
