Difference between revisions of "25-DIDEHYDRO-D-GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14290 RXN-14290] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14290 RXN-14290] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 2 [[CPD-12377]][c] '''+''' 1 [[DATP]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-13851]][c] |
| − | == | + | * With common name(s): |
| + | ** 2 hydroxyl radical[c] '''+''' 1 dATP[c] '''=>''' 1 H2O[c] '''+''' 1 2-hydroxy-dATP[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
| − | {{#set: | + | |
Revision as of 17:30, 10 January 2018
Contents
Reaction RXN-14290
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 hydroxyl radical[c] + 1 dATP[c] => 1 H2O[c] + 1 2-hydroxy-dATP[c]
