Difference between revisions of "PHOSPHORIBOSYL-AMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N |
* common name: | * common name: | ||
− | ** | + | ** 5-androstene-3,17-dione |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 286.413 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** androst-5-ene-3,17-dione |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-342]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20252 C20252] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.543261.html 543261] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83865 83865] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160531 160531] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=5-androstene-3,17-dione}} |
− | {{#set: common name= | + | {{#set: molecular weight=286.413 }} |
− | {{#set: | + | {{#set: common name=androst-5-ene-3,17-dione}} |
+ | {{#set: produced by=RXN66-342}} |
Revision as of 17:31, 10 January 2018
Contents
Metabolite CPD66-29
- smiles:
- CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)
- inchi key:
- InChIKey=SQGZFRITSMYKRH-QAGGRKNESA-N
- common name:
- 5-androstene-3,17-dione
- molecular weight:
- 286.413
- Synonym(s):
- androst-5-ene-3,17-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4)" cannot be used as a page name in this wiki.