Difference between revisions of "1-3-alpha-D-Glucans"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12647 == * Synonym(s): == Reactions associated == * 2.3.2.15-RXN ** pantograph-esiliculosus == Pathways associated == * PWY-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N | ||
+ | * common name: | ||
+ | ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol | ||
+ | * molecular weight: | ||
+ | ** 835.347 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol | ||
+ | ** 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-9235]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986092 50986092] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64181 64181] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N}} | ||
+ | {{#set: common name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}} | ||
+ | {{#set: molecular weight=835.347 }} | ||
+ | {{#set: common name=6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol|6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol}} | ||
+ | {{#set: produced by=RXN-9235}} |
Revision as of 17:32, 10 January 2018
Contents
Metabolite CPD-9871
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
- common name:
- 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
- molecular weight:
- 835.347
- Synonym(s):
- 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
- 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links