Difference between revisions of "ORNDECARBOX-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17305 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-athaliana == Pathways associated == * PWY-5381...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == |
+ | * smiles: | ||
+ | ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C | ||
+ | * inchi key: | ||
+ | ** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N | ||
+ | * common name: | ||
+ | ** zeinoxanthin | ||
+ | * molecular weight: | ||
+ | ** 552.882 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β,ε-carotene-3-ol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-5962]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-5961]] |
− | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] | ||
+ | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}} | ||
+ | {{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}} | ||
+ | {{#set: common name=zeinoxanthin}} | ||
+ | {{#set: molecular weight=552.882 }} | ||
+ | {{#set: common name=β,ε-carotene-3-ol}} | ||
+ | {{#set: consumed by=RXN-5962}} | ||
+ | {{#set: produced by=RXN-5961}} |
Revision as of 18:33, 10 January 2018
Contents
Metabolite CPD-5661
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
- inchi key:
- InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
- common name:
- zeinoxanthin
- molecular weight:
- 552.882
- Synonym(s):
- β,ε-carotene-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links