Difference between revisions of "PYRAMKIN-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12875 == * left end position: ** 73 * transcription direction: ** POSITIVE * right end position: ** 3590 * centisome position: ** 1.0952739...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14422 CPD-14422] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14422 CPD-14422] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DFYFQQXXTCLFNG-UBQHHBPXSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-icosatrienoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1065.958 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (9Z,12Z,15Z)-octadecatrienoyl-CoA | ||
| + | ** 3-oxo-eicosatrienoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12994]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13441]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581047 71581047] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74054 74054] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=DFYFQQXXTCLFNG-UBQHHBPXSA-J}} |
| + | {{#set: common name=3-oxo-icosatrienoyl-CoA}} | ||
| + | {{#set: molecular weight=1065.958 }} | ||
| + | {{#set: common name=(9Z,12Z,15Z)-octadecatrienoyl-CoA|3-oxo-eicosatrienoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-12994}} | ||
| + | {{#set: produced by=RXN-13441}} | ||
Revision as of 17:33, 10 January 2018
Contents
Metabolite CPD-14422
- smiles:
- CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=DFYFQQXXTCLFNG-UBQHHBPXSA-J
- common name:
- 3-oxo-icosatrienoyl-CoA
- molecular weight:
- 1065.958
- Synonym(s):
- (9Z,12Z,15Z)-octadecatrienoyl-CoA
- 3-oxo-eicosatrienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
