Difference between revisions of "Tiso gene 5022"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-161 RXN66-161] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == |
− | * | + | * smiles: |
− | ** | + | ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N |
+ | * common name: | ||
+ | ** serotonin O-sulfate | ||
+ | * molecular weight: | ||
+ | ** 256.276 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxytryptamine O-sulfate | ||
+ | ** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate | ||
+ | ** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10777]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.134104.html 134104] |
− | {{#set: | + | {{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: common name=serotonin O-sulfate}} |
+ | {{#set: molecular weight=256.276 }} | ||
+ | {{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}} | ||
+ | {{#set: produced by=RXN-10777}} |
Revision as of 17:33, 10 January 2018
Contents
Metabolite CPD-11665
- smiles:
- C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
- inchi key:
- InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
- common name:
- serotonin O-sulfate
- molecular weight:
- 256.276
- Synonym(s):
- 5-hydroxytryptamine O-sulfate
- 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
- 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links