Difference between revisions of "RXN-14024"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == * smiles: ** [CH](=O)C(O)C(=O)[O-] * inchi key: ** InChIK...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7814 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] ==
+
== Gene Tiso_gene_7814 ==
* smiles:
+
** [CH](=O)C(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M
+
* common name:
+
** tartronate semialdehyde
+
* molecular weight:
+
** 103.054   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxy-3-oxopropanoate
 
** tartronic semialdehyde
 
** hydroxymalonaldehydic acid
 
** tartronate-S-ald
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[R01747]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
* [[RXN0-5289]]
+
* [[RXN0-305]]
+
* [[4.1.2.20-RXN]]
+
* [[KDGALDOL-RXN]]
+
 
== External links  ==
 
== External links  ==
* CAS : 2480-77-5
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22134427 22134427]
+
* HMDB : HMDB06938
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01146 C01146]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57978 57978]
+
* BIGG : 2h3oppan
+
{{#set: smiles=[CH](=O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M}}
+
{{#set: common name=tartronate semialdehyde}}
+
{{#set: molecular weight=103.054    }}
+
{{#set: common name=2-hydroxy-3-oxopropanoate|tartronic semialdehyde|hydroxymalonaldehydic acid|tartronate-S-ald}}
+
{{#set: consumed by=R01747}}
+
{{#set: consumed or produced by=RXN0-5289|RXN0-305|4.1.2.20-RXN|KDGALDOL-RXN}}
+

Revision as of 17:34, 10 January 2018

Gene Tiso_gene_7814

  • Synonym(s):

Reactions associated

Pathways associated

External links