Difference between revisions of "Tiso gene 12839"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARIN COUMARIN] == * smiles: ** C1(OC2(=CC=CC=C(C=C1)2))=O * inchi key: ** InChIKey=ZYGHJZDH...") |
(Created page with "Category:Gene == Gene Tiso_gene_7305 == * left end position: ** 4066 * transcription direction: ** NEGATIVE * right end position: ** 11083 * centisome position: ** 35.8870...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7305 == |
− | * | + | * left end position: |
− | ** | + | ** 4066 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 11083 |
− | * | + | * centisome position: |
− | ** | + | ** 35.887028 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | == | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***automated-name-match | |
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-7492]] | ||
+ | * [[PWY-6659]] | ||
+ | * [[PWY-6691]] | ||
+ | * [[PWY-5120]] | ||
+ | * [[PWY-7720]] | ||
+ | * [[PWY-7721]] | ||
+ | * [[PWY-7517]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4066}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=11083}} | |
− | + | {{#set: centisome position=35.887028 }} | |
− | + | {{#set: reaction associated=FARNESYLTRANSTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-7492|PWY-6659|PWY-6691|PWY-5120|PWY-7720|PWY-7721|PWY-7517}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:34, 10 January 2018
Gene Tiso_gene_7305
- left end position:
- 4066
- transcription direction:
- NEGATIVE
- right end position:
- 11083
- centisome position:
- 35.887028
- Synonym(s):
Reactions associated
- FARNESYLTRANSTRANSFERASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation