Difference between revisions of "Tiso gene 13434"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYLGLYCINE GLYCYLGLYCINE] == * smiles: ** C([N+])C(=O)NCC([O-])=O * inchi key: ** InChIKey=Y...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N |
* common name: | * common name: | ||
| − | ** | + | ** vitamin K 2,3-epoxide |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 466.703 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,3-epoxyphylloquinone | ||
| + | ** 2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[1.1.4.1-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460204 5460204] |
| − | * | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.4444391.html 4444391] | |
| − | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15759 15759] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05849 C05849] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB02972 |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3)}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N}} |
| − | {{#set: consumed by= | + | {{#set: common name=vitamin K 2,3-epoxide}} |
| + | {{#set: molecular weight=466.703 }} | ||
| + | {{#set: common name=2,3-epoxyphylloquinone|2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone}} | ||
| + | {{#set: consumed or produced by=1.1.4.1-RXN}} | ||
Revision as of 17:35, 10 January 2018
Contents
Metabolite 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC13(OC(C)(C(=O)C2(C=CC=CC(C(=O)1)=2))3)
- inchi key:
- InChIKey=KUTXFBIHPWIDJQ-HBDFACPTSA-N
- common name:
- vitamin K 2,3-epoxide
- molecular weight:
- 466.703
- Synonym(s):
- 2,3-epoxyphylloquinone
- 2,3-epoxy-2,3-dihydro-2-methyl-3-phytyl-1,4-naphthoquinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
