Difference between revisions of "NTDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH OH] == * smiles: ** [O-] * inchi key: ** InChIKey=XLYOFNOQVPJJNP-UHFFFAOYSA-M * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == |
* smiles: | * smiles: | ||
| − | ** [O-] | + | ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 3-(7'-methylthio)heptylmalate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 276.347 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-(7'-methylthio)heptylmalic acid |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXNQT-4178]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-18200]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172] |
| − | + | {{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}} | |
| − | + | {{#set: common name=3-(7'-methylthio)heptylmalate}} | |
| − | + | {{#set: molecular weight=276.347 }} | |
| − | + | {{#set: common name=3-(7'-methylthio)heptylmalic acid}} | |
| − | + | {{#set: consumed by=RXNQT-4178}} | |
| − | + | {{#set: consumed or produced by=RXN-18200}} | |
| − | {{#set: smiles=[O-]}} | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: produced by=RXN- | + | |
Revision as of 17:35, 10 January 2018
Contents
Metabolite CPDQT-40
- smiles:
- CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
- common name:
- 3-(7'-methylthio)heptylmalate
- molecular weight:
- 276.347
- Synonym(s):
- 3-(7'-methylthio)heptylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
