Difference between revisions of "Tiso gene 11818"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16027 RXN-16027] == * direction: ** REVERSIBLE * common name: ** monogalactosyldiacylglycerol_s...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16027 RXN-16027] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** monogalactosyldiacylglycerol_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.46 EC-2.4.1.46] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CPD-17272]][c] '''+''' 1 [[CPD-14553]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-2187]][c] '''+''' 1 [[UDP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 1-oleoyl-2-palmitoyl-glycerol[c] '''+''' 1 UDP-α-D-galactose[c] '''<=>''' 1 H+[c] '''+''' 1 1-18:1-2-16:0-monogalactosyldiacylglycerol[c] '''+''' 1 UDP[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * [[Tiso_gene_9530]] | |
− | == | + | ** IN-SILICO_ANNOTATION |
− | * [[ | + | ***AUTOMATED-NAME-MATCH |
− | * | + | == Pathways == |
− | * | + | == Reconstruction information == |
− | + | * [[annotation]]: | |
− | + | ** [[pathwaytools]]: | |
− | * [[ | + | *** [[in-silico_annotation]] |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=monogalactosyldiacylglycerol_synthase}} | |
− | + | {{#set: ec number=EC-2.4.1.46}} | |
− | + | {{#set: gene associated=Tiso_gene_9530}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:47, 10 January 2018
Contents
Reaction RXN-16027
- direction:
- REVERSIBLE
- common name:
- monogalactosyldiacylglycerol_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 1-oleoyl-2-palmitoyl-glycerol[c] + 1 UDP-α-D-galactose[c] <=> 1 H+[c] + 1 1-18:1-2-16:0-monogalactosyldiacylglycerol[c] + 1 UDP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_9530
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION