Difference between revisions of "Reduced-Factor-F420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RPDPK RPDPK] == * direction: ** REVERSIBLE * common name: ** Ribose-phosphate diphosphokinase, chlo...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RPDPK RPDPK] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Ribose-phosphate diphosphokinase, chloroplast |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[CPD-15318]][h] '''+''' 1.0 [[ATP]][h] '''<=>''' 1.0 [[AMP]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[PRPP]][h] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 α-D-ribose 5-phosphate[h] '''+''' 1.0 ATP[h] '''<=>''' 1.0 AMP[h] '''+''' 1.0 H+[h] '''+''' 1.0 5-phospho-α-D-ribose 1-diphosphate[h] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_4677]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Ribose-phosphate diphosphokinase, chloroplast}} | |
| − | + | {{#set: gene associated=Tiso_gene_4677}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:36, 10 January 2018
Contents
Reaction RPDPK
- direction:
- REVERSIBLE
- common name:
- Ribose-phosphate diphosphokinase, chloroplast
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 α-D-ribose 5-phosphate[h] + 1.0 ATP[h] <=> 1.0 AMP[h] + 1.0 H+[h] + 1.0 5-phospho-α-D-ribose 1-diphosphate[h]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
