Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_4112 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-athaliana ** [[pantograph]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4112 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
− | + | ** [[pantograph]]-[[athaliana]] | |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
+ | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7539]] | ||
+ | * [[PWY-6797]] | ||
+ | * [[PWY-6147]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN|H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} | |
− | + | {{#set: pathway associated=PWY-7539|PWY-6797|PWY-6147}} | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 17:37, 10 January 2018
Gene Tiso_gene_4112
- Synonym(s):