Difference between revisions of "N-acetyl-D-glucosamine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12510 RXN-12510] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12510 RXN-12510] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.13.21 EC-1.14.13.21]
+
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
 +
* common name:
 +
** 3-oxo-24-ethyl-cholest-5-ene
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-90]][c] '''=>''' 1 [[CPD-520]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-12789]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 kaempferol[c] '''=>''' 1 quercetin[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_1547]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06538 R06538]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: ec number=EC-1.14.13.21}}
+
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
−
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_1547}}
+
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
−
{{#set: in pathway=PWY-3101}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-12789}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=athaliana}}
+

Revision as of 17:37, 10 January 2018

Metabolite CPD-13793

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
  • common name:
    • 3-oxo-24-ethyl-cholest-5-ene
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-acetyl-D-glucosamine&oldid=18727"