Difference between revisions of "RXN1G-193"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20066 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-esiliculosus == Pathways associated == * PWY-751...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == |
| + | * smiles: | ||
| + | ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J | ||
| + | * common name: | ||
| + | ** D-myo-inositol (3,4)-bisphosphate | ||
| + | * molecular weight: | ||
| + | ** 336.085 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1D-myo-inositol (3,4)-bisphosphate | ||
| + | ** inositol (3,4)-bisphosphate | ||
| + | ** (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid | ||
| + | ** Ins(3,4)P2 | ||
| + | ** I(3,4)P2 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-10960]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-10939]] |
| − | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21120281 21120281] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19980559.html 19980559] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83241 83241] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04063 C04063] | ||
| + | * HMDB : HMDB06235 | ||
| + | {{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J}} | ||
| + | {{#set: common name=D-myo-inositol (3,4)-bisphosphate}} | ||
| + | {{#set: molecular weight=336.085 }} | ||
| + | {{#set: common name=1D-myo-inositol (3,4)-bisphosphate|inositol (3,4)-bisphosphate|(2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid|Ins(3,4)P2|I(3,4)P2}} | ||
| + | {{#set: consumed by=RXN-10960}} | ||
| + | {{#set: produced by=RXN-10939}} | ||
Revision as of 17:38, 10 January 2018
Contents
Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE
- smiles:
- C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
- inchi key:
- InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J
- common name:
- D-myo-inositol (3,4)-bisphosphate
- molecular weight:
- 336.085
- Synonym(s):
- 1D-myo-inositol (3,4)-bisphosphate
- inositol (3,4)-bisphosphate
- (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid
- Ins(3,4)P2
- I(3,4)P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.
