Difference between revisions of "Tiso gene 12450"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_5666 == * left end position: ** 887 * transcription direction: ** NEGATIVE * right end position: ** 4339 * centisome position: ** 6.780827...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5666 == |
− | * | + | * left end position: |
− | ** | + | ** 887 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4339 |
− | * | + | * centisome position: |
− | ** | + | ** 6.780827 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-13185]] |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | == | + | * [[RXN-7984]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-7985]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5945]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=887}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4339}} | |
− | + | {{#set: centisome position=6.780827 }} | |
− | + | {{#set: reaction associated=RXN-13185|RXN-7984|RXN-7985}} | |
− | + | {{#set: pathway associated=PWY-5945}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:39, 10 January 2018
Gene Tiso_gene_5666
- left end position:
- 887
- transcription direction:
- NEGATIVE
- right end position:
- 4339
- centisome position:
- 6.780827
- Synonym(s):
Reactions associated
- RXN-13185
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-7984
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-7985
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation