Difference between revisions of "AMACETOXID-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THYROXINE-DEIODINASE-RXN THYROXINE-DEIODINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == |
− | * | + | * smiles: |
− | ** | + | ** C1([N+]C(C(=O)[O-])CC(O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** trans-4-hydroxy-L-proline |
− | * | + | * molecular weight: |
− | ** | + | ** 131.131 |
* Synonym(s): | * Synonym(s): | ||
+ | ** trans-4-hydroxyproline | ||
+ | ** trans-oxyproline | ||
+ | ** trans-L-4-hydroxyproline | ||
+ | ** trans-hydroxy-L-proline | ||
+ | ** trans-L-4-hydroxy-proline | ||
+ | ** (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RME144]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-546]] | |
− | + | * [[RXN490-3641]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * NCI: |
− | ** [http:// | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46704 46704] |
− | * | + | * CAS : 51-35-4 |
− | + | * PUBCHEM: | |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971053 6971053] |
− | ** [http:// | + | * HMDB : HMDB00725 |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58375 58375] | |
− | * | + | * METABOLIGHTS : MTBLC58375 |
− | * | + | {{#set: smiles=C1([N+]C(C(=O)[O-])CC(O)1)}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N}} |
− | + | {{#set: common name=trans-4-hydroxy-L-proline}} | |
− | + | {{#set: molecular weight=131.131 }} | |
− | * | + | {{#set: common name=trans-4-hydroxyproline|trans-oxyproline|trans-L-4-hydroxyproline|trans-hydroxy-L-proline|trans-L-4-hydroxy-proline|(2S,4R)-4-hydroxypyrrolidinium-2-carboxylate}} |
− | {{#set: | + | {{#set: consumed by=RME144}} |
− | {{#set: | + | {{#set: produced by=RXN66-546|RXN490-3641}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:39, 10 January 2018
Contents
Metabolite 4-HYDROXY-L-PROLINE
- smiles:
- C1([N+]C(C(=O)[O-])CC(O)1)
- inchi key:
- InChIKey=PMMYEEVYMWASQN-DMTCNVIQSA-N
- common name:
- trans-4-hydroxy-L-proline
- molecular weight:
- 131.131
- Synonym(s):
- trans-4-hydroxyproline
- trans-oxyproline
- trans-L-4-hydroxyproline
- trans-hydroxy-L-proline
- trans-L-4-hydroxy-proline
- (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1([N+]C(C(=O)[O-])CC(O)1)" cannot be used as a page name in this wiki.