Difference between revisions of "SHIKIMATE-5-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-471 RXN1G-471] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-471 RXN1G-471] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
 
* common name:
 
* common name:
** trans-delta2-cis,cis-delta19,37-C56:3-[acyl-carrier protein] reductase
+
** 5-methylhex-4-enoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** 873.658   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-cis-D19-37-C56-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D19-37-C56-2-ACPs]][c]
+
* [[RXN-11917]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H+[c] '''+''' 1 a trans-delta2-cis,cis-delta19,37-C56:3-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta19-37-C56:2-[acp][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_10778]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
** '''86''' reactions found over '''182''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=trans-delta2-cis,cis-delta19,37-C56:3-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179]
{{#set: ec number=EC-1.3.1.M4}}
+
* LIGAND-CPD:
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470]
{{#set: in pathway=PWYG-321}}
+
{{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=5-methylhex-4-enoyl-CoA}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=873.658    }}
 +
{{#set: produced by=RXN-11917}}

Revision as of 17:40, 10 January 2018

Metabolite CPD-12902

  • smiles:
    • CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
  • common name:
    • 5-methylhex-4-enoyl-CoA
  • molecular weight:
    • 873.658
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.