Difference between revisions of "UBIQUINONE-8"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1124 RXN-1124] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ident...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1124 RXN-1124] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
* common name:
+
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
* molecular weight:
+
** 985.829   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-14:1-Δ7-CoA
 
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17795]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[SINAPOYL-COA]][c] '''<=>''' 1 [[NADP]][c] '''+''' 1 [[SINAPALDEHYDE]][c] '''+''' 1 [[CO-A]][c]
* [[RXN-17794]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 sinapoyl-CoA[c] '''<=>''' 1 NADP+[c] '''+''' 1 sinapaldehyde[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15272]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_9504]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_11016]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R02220 R02220]
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: direction=REVERSIBLE}}
{{#set: molecular weight=985.829    }}
+
{{#set: gene associated=Tiso_gene_15272|Tiso_gene_9504|Tiso_gene_11016}}
{{#set: common name=3-oxo-14:1-&Delta;7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: in pathway=}}
{{#set: consumed by=RXN-17795}}
+
{{#set: reconstruction category=orthology}}
{{#set: produced by=RXN-17794}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 17:52, 18 March 2018

Reaction RXN-1124

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 NADPH[c] + 1 sinapoyl-CoA[c] <=> 1 NADP+[c] + 1 sinapaldehyde[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links