Difference between revisions of "1.21.3.1-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15067 == * left end position: ** 496 * transcription direction: ** NEGATIVE * right end position: ** 5231 * centisome position: ** 9.435039...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15067 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
−
* left end position:
+
* smiles:
−
** 496
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
−
* right end position:
+
* common name:
−
** 5231
+
** 8-oxo-GTP
−
* centisome position:
+
* molecular weight:
−
** 9.435039    
+
** 535.151    
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-guanosine-triphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.2.1.21-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-11409]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-10769]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-10773]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-13602]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-13603]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-14179]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-5341]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-8036]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[RXN-9674]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-3121]]
+
−
* [[PWY-6002]]
+
−
* [[PWY-6788]]
+
−
* [[PWY-5176]]
+
−
* [[PWY-7092]]
+
−
* [[PWY-7091]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=496}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
−
{{#set: right end position=5231}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: centisome position=9.435039   }}
+
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
−
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
+
{{#set: common name=8-oxo-GTP}}
−
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091}}
+
{{#set: molecular weight=535.151   }}
 +
{{#set: common name=8-oxo-guanosine-triphosphate}}
 +
{{#set: produced by=RXN-11409}}

Revision as of 15:48, 10 January 2018

Metabolite CPD-12366

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
  • common name:
    • 8-oxo-GTP
  • molecular weight:
    • 535.151
  • Synonym(s):
    • 8-oxo-guanosine-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.21.3.1-RXN&oldid=10459"