Difference between revisions of "X5NT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_8982 == * Synonym(s): == Reactions associated == * RXN-4210 ** pantograph-esiliculosus * RXN-707 ** pantograph-esili...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Gene Tiso_gene_8982 ==
* smiles:
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
* inchi key:
+
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
* common name:
+
** gibberellin A12
+
* molecular weight:
+
** 330.423   
+
 
* Synonym(s):
 
* Synonym(s):
** C20-GAs
 
** open lactone gibberrellin skeleton
 
** C20 skeleton
 
** C20-GA skeleton
 
** C20-gibberellin skeleton
 
** GA12
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-162]]
+
* [[RXN-4210]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
* [[RXN1F-161]]
+
* [[RXN-707]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN66-27]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN66-323]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY66-341]]
 +
* [[PWY66-3]]
 +
* [[PWY-2541]]
 +
* [[PWY66-4]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170014
+
{{#set: reaction associated=RXN-4210|RXN-707|RXN66-27|RXN66-323}}
* PUBCHEM:
+
{{#set: pathway associated=PWY66-341|PWY66-3|PWY-2541|PWY66-4}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
{{#set: common name=gibberellin A12}}
+
{{#set: molecular weight=330.423    }}
+
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
{{#set: consumed by=RXN1F-162}}
+
{{#set: produced by=RXN1F-161}}
+

Revision as of 17:54, 18 March 2018

Gene Tiso_gene_8982

  • Synonym(s):

Reactions associated

Pathways associated

External links