Difference between revisions of "PWY-7560"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7165 PWY-7165] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7165 PWY-7165] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
+
 
* common name:
 
* common name:
** 4-trans-3-oxo-undecenoyl-CoA
+
** L-ascorbate biosynthesis VI (engineered pathway)
* molecular weight:
+
** 943.749   
+
 
* Synonym(s):
 
* Synonym(s):
** 4E-3-oxo-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14793]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.274-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_18748]]
 +
*** [[Tiso_gene_8988]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[GLUCONOLACT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_1947]]
 +
*** [[Tiso_gene_15098]]
 +
*** [[Tiso_gene_1948]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROGLUCONATE-DEHYDROGENASE-RXN DEHYDROGLUCONATE-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-2-DEHYDROGENASE-RXN GLUCONATE-2-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12108 RXN-12108]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6373 RXN0-6373]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7020 RXN0-7020]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
+
{{#set: common name=L-ascorbate biosynthesis VI (engineered pathway)}}
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
+
{{#set: total reaction=7}}
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
+
{{#set: completion rate=29.0}}
{{#set: molecular weight=943.749    }}
+
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14793}}
+

Revision as of 17:54, 18 March 2018

Pathway PWY-7165

  • taxonomic range:
  • common name:
    • L-ascorbate biosynthesis VI (engineered pathway)
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links