Difference between revisions of "HOMOGENTISATE-12-DIOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCERO-PHOSPHORYLCHOLINE L-1-GLYCERO-PHOSPHORYLCHOLINE] == * smiles: ** C([N+](C)(C)C)COP(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCERO-PHOSPHORYLCHOLINE L-1-GLYCERO-PHOSPHORYLCHOLINE] == |
− | * | + | * smiles: |
− | ** | + | ** C([N+](C)(C)C)COP([O-])(=O)OCC(O)CO |
+ | * inchi key: | ||
+ | ** InChIKey=SUHOQUVVVLNYQR-MRVPVSSYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** sn-glycero-3-phosphocholine |
− | * | + | * molecular weight: |
− | ** | + | ** 257.223 |
* Synonym(s): | * Synonym(s): | ||
+ | ** sn-3-GPC | ||
+ | ** glycero-phosphocholine | ||
+ | ** L-1-glycero-3-phosphocholine | ||
+ | ** L-1-glycero-phosphorylcholine | ||
+ | ** glycerophosphocholine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14899]] | |
− | + | * [[LYSOPHOSPHOLIPASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?D07349 D07349] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16870 16870] |
− | * | + | * BIGG : g3pc |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=657272 657272] |
− | + | {{#set: smiles=C([N+](C)(C)C)COP([O-])(=O)OCC(O)CO}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=SUHOQUVVVLNYQR-MRVPVSSYSA-N}} |
− | {{#set: | + | {{#set: common name=sn-glycero-3-phosphocholine}} |
− | {{#set: | + | {{#set: molecular weight=257.223 }} |
− | {{#set: | + | {{#set: common name=sn-3-GPC|glycero-phosphocholine|L-1-glycero-3-phosphocholine|L-1-glycero-phosphorylcholine|glycerophosphocholine}} |
− | {{#set: | + | {{#set: produced by=RXN-14899|LYSOPHOSPHOLIPASE-RXN}} |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 18:54, 18 March 2018
Contents
Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE
- smiles:
- C([N+](C)(C)C)COP([O-])(=O)OCC(O)CO
- inchi key:
- InChIKey=SUHOQUVVVLNYQR-MRVPVSSYSA-N
- common name:
- sn-glycero-3-phosphocholine
- molecular weight:
- 257.223
- Synonym(s):
- sn-3-GPC
- glycero-phosphocholine
- L-1-glycero-3-phosphocholine
- L-1-glycero-phosphorylcholine
- glycerophosphocholine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+](C)(C)C)COP([O-])(=O)OCC(O)CO" cannot be used as a page name in this wiki.