Difference between revisions of "Tiso gene 3445"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] ** [ht...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66] ==
−
* smiles:
+
* taxonomic range:
−
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
+
 
* common name:
 
* common name:
−
** 1,2-dihydro-β-NADP
+
** GDP-L-fucose biosynthesis I (from GDP-D-mannose)
−
* molecular weight:
+
−
** 741.394   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
+
** GDP-L-fucose biosynthesis I (de novo synthesis)
−
** 2DHNADP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
−
* [[RXN-16765]]
+
* [[1.1.1.271-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_16970]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GDPMANDEHYDRA-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_13093]]
 +
*** [[Tiso_gene_13092]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92136136 92136136]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-66 PWY-66]
−
* CHEBI:
+
* ARACYC:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=88137 88137]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-66 PWY-66]
−
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
+
{{#set: taxonomic range=TAX-2759}}
−
{{#set: common name=1,2-dihydro-β-NADP}}
+
{{#set: common name=GDP-L-fucose biosynthesis I (from GDP-D-mannose)}}
−
{{#set: molecular weight=741.394    }}
+
{{#set: common name=GDP-L-fucose biosynthesis I (de novo synthesis)}}
−
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
+
{{#set: reaction found=2}}
−
{{#set: produced by=RXN-16765}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=100.0}}

Revision as of 17:54, 18 March 2018

Pathway PWY-66

  • taxonomic range:
  • common name:
    • GDP-L-fucose biosynthesis I (from GDP-D-mannose)
  • Synonym(s):
    • GDP-L-fucose biosynthesis I (de novo synthesis)

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3445&oldid=20586"