Difference between revisions of "PWY-4101"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Gene == Gene Tiso_gene_12472 == * Synonym(s): == Reactions associated == * 3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN ** pantograph-creinhardtii * HBNOm...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12472 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
− | + | ** [[pantograph]]-[[creinhardtii]] | |
− | == | + | * [[HBNOm]] |
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-367]] | ||
+ | * [[PWY66-368]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN|HBNOm}} | |
− | + | {{#set: pathway associated=PWY66-367|PWY66-368}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 18:55, 18 March 2018
Gene Tiso_gene_12472
- Synonym(s):