Difference between revisions of "RXN-5468"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5532 PWY-5532] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 5-hydroxyindole thiazolidine carboxylate
+
** nucleoside and nucleotide degradation (archaea)
−
* molecular weight:
+
−
** 278.325   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxyindole thiazolidine carboxylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''3''' reaction(s) found
−
== Reaction(s) of unknown directionality ==
+
** [[URPHOS-RXN]]
−
* [[RXN-10779]]
+
** [[CYTIKIN-RXN]]
 +
** [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 +
== Reaction(s) not found ==
 +
* '''7''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=ADENPHOSPHOR-RXN ADENPHOSPHOR-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14699 RXN-14699]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14700 RXN-14700]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17337 RXN-17337]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8801 RXN-8801]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8800 RXN-8800]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334]
+
{{#set: common name=nucleoside and nucleotide degradation (archaea)}}
−
* CHEMSPIDER:
+
{{#set: reaction found=3}}
−
** [http://www.chemspider.com/Chemical-Structure.169392.html 169392]
+
{{#set: reaction not found=7}}
−
{{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}}
+
−
{{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}}
+
−
{{#set: common name=5-hydroxyindole thiazolidine carboxylate}}
+
−
{{#set: molecular weight=278.325    }}
+
−
{{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}}
+
−
{{#set: consumed or produced by=RXN-10779}}
+

Revision as of 15:41, 10 January 2018

Pathway PWY-5532

  • taxonomic range:
  • common name:
    • nucleoside and nucleotide degradation (archaea)
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-5468&oldid=10010"