Difference between revisions of "Tiso gene 19650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19650 == * left end position: ** 1900 * transcription direction: ** POSITIVE * right end position: ** 2014 * centisome position: ** 88.7435...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_19650 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
* left end position:
+
* smiles:
** 1900
+
** CC([CH]=O)C(=O)[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
* right end position:
+
* common name:
** 2014
+
** (R)-methylmalonate-semialdehyde
* centisome position:
+
* molecular weight:
** 88.743576    
+
** 101.082    
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2-methyl-3-oxopropanoate
 +
** (R)-ch3-malonate-semialdehyde
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.1.47-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[RXN-14056]]
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1900}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
{{#set: right end position=2014}}
+
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
{{#set: centisome position=88.743576   }}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
{{#set: reaction associated=3.1.1.47-RXN}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
 +
{{#set: molecular weight=101.082   }}
 +
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
 +
{{#set: consumed or produced by=RXN-14056}}

Revision as of 16:42, 10 January 2018

Metabolite CPD-12177

  • smiles:
    • CC([CH]=O)C(=O)[O-]
  • inchi key:
    • InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
  • common name:
    • (R)-methylmalonate-semialdehyde
  • molecular weight:
    • 101.082
  • Synonym(s):
    • (R)-2-methyl-3-oxopropanoate
    • (R)-ch3-malonate-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.