Difference between revisions of "RXN-14120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8872 RXN-8872] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8872 RXN-8872] ==
* smiles:
+
* direction:
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
* common name:
+
** cob(I)yrinate a,c-diamide
+
* molecular weight:
+
** 931.9   
+
 
* Synonym(s):
 
* Synonym(s):
** cob(I)yrinic acid a,c-diamide
 
** Cob(I)yrinate diamide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R344-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[4-HYDROXYBENZALDEHYDE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[CPD-7616]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-hydroxybenzaldehyde[c] '''+''' 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''=>''' 1 3,4-dihydroxybenzaldehyde[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_1035]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5665]], vanillin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5665 PWY-5665]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-7826]], Amaryllidacea alkaloids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7826 PWY-7826]
 +
** '''2''' reactions found over '''25''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
{{#set: ec number=EC-1.14.14.1}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_1035}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
{{#set: in pathway=PWY-5665|PWY-7826}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB06904
+
{{#set: reconstruction source=esiliculosus}}
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
{{#set: molecular weight=931.9    }}
+
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
{{#set: consumed by=R344-RXN}}
+

Revision as of 15:42, 10 January 2018

Reaction RXN-8872

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5665, vanillin biosynthesis I: PWY-5665
    • 1 reactions found over 3 reactions in the full pathway
  • PWY-7826, Amaryllidacea alkaloids biosynthesis: PWY-7826
    • 2 reactions found over 25 reactions in the full pathway

Reconstruction information

External links