Difference between revisions of "3-OXO-EICOSAPENTAENOYL-ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-L-iduronate Heparan-sulfate-L-iduronate] == * common name: ** a [heparan sulfat...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-L-iduronate Heparan-sulfate-L-iduronate] ==
* smiles:
+
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
+
* inchi key:
+
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
+
 
* common name:
 
* common name:
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
+
** a [heparan sulfate]-α-L-iduronate
* molecular weight:
+
** 285.193   
+
 
* Synonym(s):
 
* Synonym(s):
** C1-(3-Indolyl)-glycerol 3-phosphate
 
** indole-3-glycerol-P
 
** 1-(indol-3-yl)glycerol-3-P
 
** 1-(indol-3-yl)glycerol-3-phosphate
 
** indoleglycerol phosphate
 
** indole-3-glycerol-phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRYPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[IGPSYN-RXN]]
+
* [[3.1.6.13-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN0-2381]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [heparan sulfate]-α-L-iduronate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
+
{{#set: produced by=3.1.6.13-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
+
* BIGG : 3ig3p
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
+
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
+
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
+
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
+
{{#set: molecular weight=285.193    }}
+
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
+
{{#set: consumed by=TRYPSYN-RXN}}
+
{{#set: produced by=IGPSYN-RXN}}
+
{{#set: consumed or produced by=RXN0-2381}}
+

Revision as of 15:43, 10 January 2018

Metabolite Heparan-sulfate-L-iduronate

  • common name:
    • a [heparan sulfate]-α-L-iduronate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [heparan sulfate]-α-L-iduronate" cannot be used as a page name in this wiki.