Difference between revisions of "Octadec-2-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] == * direction: ** REVERSIBLE * common name: ** 3-isopropylmalate dehydrogenas...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] ==
−
* smiles:
+
* direction:
−
** C(=CC1(=CC=C(O)C=C1))CO
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
 
* common name:
 
* common name:
−
** 4-coumaryl alcohol
+
** 3-isopropylmalate dehydrogenase
−
* molecular weight:
+
−
** 150.177   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaryl alcohol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-1102]]
+
** 1 [[NAD]][c] '''+''' 1 [[CPDQT-38]][c] '''<=>''' 1 [[CPD-19489]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 3-(5'-methylthio)pentylmalate[c] '''<=>''' 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2920]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
 +
** '''10''' reactions found over '''30''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: common name=3-isopropylmalate dehydrogenase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_2920}}
−
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: in pathway=PWYQT-4450}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: reconstruction tool=pathwaytools}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=experimental_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
−
* HMDB : HMDB03654
+
−
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
−
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
−
{{#set: common name=4-coumaryl alcohol}}
+
−
{{#set: molecular weight=150.177    }}
+
−
{{#set: common name=p-coumaryl alcohol}}
+
−
{{#set: produced by=RXN-1102}}
+

Revision as of 15:43, 10 January 2018

Reaction RXN-18204

  • direction:
    • REVERSIBLE
  • common name:
    • 3-isopropylmalate dehydrogenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 3-(5'-methylthio)pentylmalate[c] <=> 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] + 1 NADH[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
    • 10 reactions found over 30 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Octadec-2-enoyl-ACPs&oldid=10154"