Difference between revisions of "Methyl-Jasmonates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLONITRILE ACRYLONITRILE] == * smiles: ** C=CC#N * inchi key: ** InChIKey=NLHHRLWOUZZQLW-UHF...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLONITRILE ACRYLONITRILE] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C=CC#N |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NLHHRLWOUZZQLW-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** acrylonitrile |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 53.063 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R310-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6362 6362] | ||
| + | * CAS : 107-13-1 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7855 7855] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01998 C01998] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.7567.html 7567] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28217 28217] |
| − | + | {{#set: smiles=C=CC#N}} | |
| − | {{#set: smiles=C | + | {{#set: inchi key=InChIKey=NLHHRLWOUZZQLW-UHFFFAOYSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=acrylonitrile}} |
| − | {{#set: common name= | + | {{#set: molecular weight=53.063 }} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=R310-RXN}} |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | + | ||
Revision as of 15:44, 10 January 2018
Contents
Metabolite ACRYLONITRILE
- smiles:
- C=CC#N
- inchi key:
- InChIKey=NLHHRLWOUZZQLW-UHFFFAOYSA-N
- common name:
- acrylonitrile
- molecular weight:
- 53.063
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
