Difference between revisions of "RXN0-5038"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** β-D-glucose 6-phosphate |
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-D-glucose-6-P | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[G6PBDHh]] |
| − | + | * [[RXN66-579]] | |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | * [[PGIB]] |
| − | + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | |
| − | ** [ | + | * [[G6PI]] |
| + | * [[G6PB_pi_th]] | ||
| + | * [[PGIBh]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] |
| − | {{#set: | + | * HMDB : HMDB03498 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] | ||
| + | * BIGG : g6p | ||
| + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} | ||
| + | {{#set: common name=β-D-glucose 6-phosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=β-D-glucose-6-P}} | ||
| + | {{#set: consumed by=G6PBDHh|RXN66-579}} | ||
| + | {{#set: consumed or produced by=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}} | ||
Revision as of 15:45, 10 January 2018
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- common name:
- β-D-glucose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.
