Difference between revisions of "PWY-6364"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] == * smiles: ** CC(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N |
* common name: | * common name: | ||
| − | ** | + | ** phylloquinone |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 450.703 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-methyl-3-phytyl-1,4-naphthoquinone | ||
| + | ** phytonadione | ||
| + | ** phytomenadione | ||
| + | ** 3-phytylmenadione | ||
| + | ** vitamin K1 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R06859]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[1.1.4.1-RXN]] | ||
== External links == | == External links == | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=270681 270681] | ||
| + | * CAS : 84-80-0 | ||
| + | * Wikipedia : Phylloquinone | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280483 5280483] |
| − | {{#set: smiles=C( | + | * HMDB : HMDB03555 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02059 C02059] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: produced by= | + | ** [http://www.chemspider.com/Chemical-Structure.4444124.html 4444124] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=583972 583972] | ||
| + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C)}} | ||
| + | {{#set: inchi key=InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N}} | ||
| + | {{#set: common name=phylloquinone}} | ||
| + | {{#set: molecular weight=450.703 }} | ||
| + | {{#set: common name=2-methyl-3-phytyl-1,4-naphthoquinone|phytonadione|phytomenadione|3-phytylmenadione|vitamin K1}} | ||
| + | {{#set: produced by=R06859}} | ||
| + | {{#set: consumed or produced by=1.1.4.1-RXN}} | ||
Revision as of 15:49, 10 January 2018
Contents
Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CCC2(=C(C(=O)C1(C=CC=CC=1C2=O))C)
- inchi key:
- InChIKey=MBWXNTAXLNYFJB-LKUDQCMESA-N
- common name:
- phylloquinone
- molecular weight:
- 450.703
- Synonym(s):
- 2-methyl-3-phytyl-1,4-naphthoquinone
- phytonadione
- phytomenadione
- 3-phytylmenadione
- vitamin K1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- CAS : 84-80-0
- Wikipedia : Phylloquinone
- PUBCHEM:
- HMDB : HMDB03555
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
