Difference between revisions of "RIBOKIN-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16992 == * left end position: ** 260 * transcription direction: ** POSITIVE * right end position: ** 1997 * centisome position: ** 6.526104...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10587 CPD-10587] == * smiles: ** CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10587 CPD-10587] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YWGOKHMOJTZGBN-WKNWCLFJSA-N |
| − | * | + | * common name: |
| − | ** | + | ** (25R)-3α,7α-dihydroxy-5β-cholestan-26-al |
| − | * | + | * molecular weight: |
| − | ** | + | ** 418.659 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9844]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-9843]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?c05445 c05445] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27428 27428] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC27428 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926303 46926303] | ||
| + | * HMDB : HMDB06894 | ||
| + | {{#set: smiles=CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}} | ||
| + | {{#set: inchi key=InChIKey=YWGOKHMOJTZGBN-WKNWCLFJSA-N}} | ||
| + | {{#set: common name=(25R)-3α,7α-dihydroxy-5β-cholestan-26-al}} | ||
| + | {{#set: molecular weight=418.659 }} | ||
| + | {{#set: consumed by=RXN-9844}} | ||
| + | {{#set: produced by=RXN-9843}} | ||
Revision as of 15:49, 10 January 2018
Contents
Metabolite CPD-10587
- smiles:
- CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
- inchi key:
- InChIKey=YWGOKHMOJTZGBN-WKNWCLFJSA-N
- common name:
- (25R)-3α,7α-dihydroxy-5β-cholestan-26-al
- molecular weight:
- 418.659
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([CH]=O)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.
