Difference between revisions of "CPD-7033"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) |
| + | * inchi key: | ||
| + | ** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 3,3',5-triiodothyroacetate |
| + | * molecular weight: | ||
| + | ** 620.928 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3,3',5-triiodothyroacetic acid | ||
| + | ** Triac | ||
| + | ** Tiratricol | ||
| + | ** Tiracana | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10618]] | |
| − | + | * [[RXN-10619]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972] |
| + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}} | ||
| + | {{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=3,3',5-triiodothyroacetate}} | ||
| + | {{#set: molecular weight=620.928 }} | ||
| + | {{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}} | ||
| + | {{#set: consumed by=RXN-10618|RXN-10619}} | ||
Revision as of 15:50, 10 January 2018
Contents
Metabolite CPD-11404
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
- inchi key:
- InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
- common name:
- 3,3',5-triiodothyroacetate
- molecular weight:
- 620.928
- Synonym(s):
- 3,3',5-triiodothyroacetic acid
- Triac
- Tiratricol
- Tiracana
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.
