Difference between revisions of "PWY-7198"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2183 CPD-2183] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCC)COP(=O)([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])C=CC1(=CC=CC=C1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M |
* common name: | * common name: | ||
| − | ** | + | ** trans-cinnamate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 147.153 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** β-phenylacrylic acid |
| − | ** | + | ** 3-phenyl-2-propenoic acid |
| − | ** | + | ** cinnamic acid |
| + | ** cinnamate | ||
| + | ** trans-cinnamic acid | ||
| + | ** (E)-cinnamate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-2001]] | ||
| + | * [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 140-10-3 | ||
| + | * METABOLIGHTS : MTBLC15669 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5957728 5957728] |
| + | * HMDB : HMDB00930 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00423 C00423] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4762929.html 4762929] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15669 15669] |
| − | * | + | * BIGG : cinnm |
| − | {{#set: smiles= | + | {{#set: smiles=C(=O)([O-])C=CC1(=CC=CC=C1)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=trans-cinnamate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=147.153 }} |
| − | {{#set: common name= | + | {{#set: common name=β-phenylacrylic acid|3-phenyl-2-propenoic acid|cinnamic acid|cinnamate|trans-cinnamic acid|(E)-cinnamate}} |
| − | {{#set: | + | {{#set: consumed by=RXN-2001|TRANS-CINNAMATE-4-MONOOXYGENASE-RXN}} |
Revision as of 15:51, 10 January 2018
Contents
Metabolite CPD-674
- smiles:
- C(=O)([O-])C=CC1(=CC=CC=C1)
- inchi key:
- InChIKey=WBYWAXJHAXSJNI-VOTSOKGWSA-M
- common name:
- trans-cinnamate
- molecular weight:
- 147.153
- Synonym(s):
- β-phenylacrylic acid
- 3-phenyl-2-propenoic acid
- cinnamic acid
- cinnamate
- trans-cinnamic acid
- (E)-cinnamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 140-10-3
- METABOLIGHTS : MTBLC15669
- PUBCHEM:
- HMDB : HMDB00930
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : cinnm
"C(=O)([O-])C=CC1(=CC=CC=C1)" cannot be used as a page name in this wiki.
