Difference between revisions of "DAD2PT"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Diacylglycerolhomoserines Diacylglycerolhomoserines] == * common name: ** a diacylglycerolhomos...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Diacylglycerolhomoserines Diacylglycerolhomoserines] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a diacylglycerolhomoserine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** DGHS |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12348]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12347]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a diacylglycerolhomoserine}} | |
| − | + | {{#set: common name=DGHS}} | |
| − | + | {{#set: consumed by=RXN-12348}} | |
| − | + | {{#set: produced by=RXN-12347}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 15:51, 10 January 2018
Contents
Metabolite Diacylglycerolhomoserines
- common name:
- a diacylglycerolhomoserine
- Synonym(s):
- DGHS
