Difference between revisions of "Tiso gene 2508"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P341-PWY P341-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
+
 
* common name:
 
* common name:
−
** D-galactosylononitol
+
** glycolysis V (Pyrococcus)
−
* molecular weight:
+
−
** 356.326   
+
 
* Synonym(s):
 
* Synonym(s):
−
** galactosyl sequoyitol
+
** archaeal Embden-Meyerhof pathway
−
** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
+
** archaeal Embden-Meyerhof-Parnas pathway
 +
** archaeal EMP pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''6''' reaction(s) found
−
* [[RXN-8281]]
+
** [[3PGAREARR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[TRIOSEPISOMERIZATION-RXN]]
 +
** [[PEPDEPHOS-RXN]]
 +
** [[PGLUCISOM-RXN]]
 +
** [[2PGADEHYDRAT-RXN]]
 +
** [[F16ALDOLASE-RXN]]
 +
== Reaction(s) not found ==
 +
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=1.2.7.6-RXN 1.2.7.6-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17001 RXN-17001]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R302-RXN R302-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605]
+
{{#set: common name=glycolysis V (Pyrococcus)}}
−
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}}
+
{{#set: common name=archaeal Embden-Meyerhof pathway|archaeal Embden-Meyerhof-Parnas pathway|archaeal EMP pathway}}
−
{{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}}
+
{{#set: reaction found=6}}
−
{{#set: common name=D-galactosylononitol}}
+
{{#set: reaction not found=3}}
−
{{#set: molecular weight=356.326    }}
+
−
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}}
+
−
{{#set: produced by=RXN-8281}}
+

Revision as of 15:52, 10 January 2018

Pathway P341-PWY

  • taxonomic range:
  • common name:
    • glycolysis V (Pyrococcus)
  • Synonym(s):
    • archaeal Embden-Meyerhof pathway
    • archaeal Embden-Meyerhof-Parnas pathway
    • archaeal EMP pathway

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2508&oldid=10689"