Difference between revisions of "5.1.1.18-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARGINASE-RXN ARGINASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARGINASE-RXN ARGINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.3.1 EC-3.5.3.1]
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
 +
* common name:
 +
** cathasterone
 +
* molecular weight:
 +
** 432.685   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-716]]
−
** 1 [[WATER]][c] '''+''' 1 [[ARG]][c] '''<=>''' 1 [[UREA]][c] '''+''' 1 [[L-ORNITHINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-715]]
−
** 1 H2O[c] '''+''' 1 L-arginine[c] '''<=>''' 1 urea[c] '''+''' 1 L-ornithine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4415]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[ARGASEDEG-PWY]], L-arginine degradation I (arginase pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARGASEDEG-PWY ARGASEDEG-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6922]], L-N&delta;-acetylornithine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922]
+
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
−
* [[ARG-PRO-PWY]], L-arginine degradation VI (arginase 2 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-PRO-PWY ARG-PRO-PWY]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
* [[ARG-GLU-PWY]], L-arginine degradation VII (arginase 3 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-GLU-PWY ARG-GLU-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-4984]], urea cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6305]], putrescine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY]
+
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20569 20569]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00551 R00551]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P05089 P05089]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
−
** [http://www.uniprot.org/uniprot/P07824 P07824]
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
** [http://www.uniprot.org/uniprot/P40906 P40906]
+
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
−
** [http://www.uniprot.org/uniprot/Q7M0Z3 Q7M0Z3]
+
{{#set: common name=cathasterone}}
−
** [http://www.uniprot.org/uniprot/P14012 P14012]
+
{{#set: molecular weight=432.685    }}
−
** [http://www.uniprot.org/uniprot/P37818 P37818]
+
{{#set: consumed by=RXN-716}}
−
** [http://www.uniprot.org/uniprot/P49900 P49900]
+
{{#set: produced by=RXN-715}}
−
** [http://www.uniprot.org/uniprot/P39138 P39138]
+
−
** [http://www.uniprot.org/uniprot/P53608 P53608]
+
−
** [http://www.uniprot.org/uniprot/P72703 P72703]
+
−
** [http://www.uniprot.org/uniprot/O68051 O68051]
+
−
** [http://www.uniprot.org/uniprot/O49046 O49046]
+
−
** [http://www.uniprot.org/uniprot/O76895 O76895]
+
−
** [http://www.uniprot.org/uniprot/P33280 P33280]
+
−
** [http://www.uniprot.org/uniprot/Q10066 Q10066]
+
−
** [http://www.uniprot.org/uniprot/P00812 P00812]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-3.5.3.1}}
+
−
{{#set: gene associated=Tiso_gene_4415}}
+
−
{{#set: in pathway=ARGASEDEG-PWY|PWY-6922|ARG-PRO-PWY|ARG-GLU-PWY|PWY-4984|PWY-6305|CITRULBIO-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus|athaliana}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Revision as of 15:52, 10 January 2018

Metabolite CPD-714

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
  • common name:
    • cathasterone
  • molecular weight:
    • 432.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5.1.1.18-RXN&oldid=10740"