Difference between revisions of "TRANS-23-DEHYDROADIPYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-20...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1G-0 PWY1G-0] ==
−
* smiles:
+
* taxonomic range:
−
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
−
* inchi key:
+
−
** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
+
 
* common name:
 
* common name:
−
** mycophenolate
+
** mycothiol biosynthesis
−
* molecular weight:
+
−
** 319.333   
+
 
* Synonym(s):
 
* Synonym(s):
−
** mycophenolic acid
+
** MSH biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-13608]]
+
* '''1''' reaction(s) found
−
* [[RXN-13607]]
+
** [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
−
== Reaction(s) of unknown directionality ==
+
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-121 RXN1G-121]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2 RXN1G-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-6501 RXN-6501]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4 RXN1G-4]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11015 RXN-11015]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-201174}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995]
+
{{#set: common name=mycothiol biosynthesis}}
−
* CHEBI:
+
{{#set: common name=MSH biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932]
+
{{#set: reaction found=1}}
−
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}}
+
{{#set: reaction not found=5}}
−
{{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}}
+
−
{{#set: common name=mycophenolate}}
+
−
{{#set: molecular weight=319.333    }}
+
−
{{#set: common name=mycophenolic acid}}
+
−
{{#set: consumed by=RXN-13608|RXN-13607}}
+

Revision as of 15:52, 10 January 2018

Pathway PWY1G-0

  • taxonomic range:
  • common name:
    • mycothiol biosynthesis
  • Synonym(s):
    • MSH biosynthesis

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRANS-23-DEHYDROADIPYL-COA&oldid=10751"